ChemNet > CAS > 465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
| product Name |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
| CAS No |
465514-67-4 |
| Synonyms |
4-[(3-methoxyphenyl)acetyl]benzonitrile |
| Molecular Formula |
C16H13NO2 |
| Molecular Weight |
251.2799 |
| InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
| Molecular Structure |
![465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile](https://images-a.chemnet.com/suppliers/chembase/168/16856.gif)
|
| Density |
1.18g/cm3 |
| Melting point |
113.9℃ |
| Boiling point |
445.6°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
194.4°C |
| Vapour Pressur |
3.9E-08mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
